C22H18ClN5O2 — CID 137228776
9-(4-chlorophenyl)-3-phenyldiazenyl-1,4,5,6,7,9-hexahydropyrazolo[5,1-b]quinazoline-2,8-dione (PubChem CID 137228776) has the molecular formula C22H18ClN5O2 and a molecular weight of 419.87 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-3-phenyldiazenyl-1,4,5,6,7,9-hexahydropyrazolo[5,1-b]quinazoline-2,8-dione.
| Compound Name | 9-(4-chlorophenyl)-3-phenyldiazenyl-1,4,5,6,7,9-hexahydropyrazolo[5,1-b]quinazoline-2,8-dione |
|---|---|
| PubChem CID | 137228776 |
| Molecular Formula | C22H18ClN5O2 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 9-(4-chlorophenyl)-3-phenyldiazenyl-1,4,5,6,7,9-hexahydropyrazolo[5,1-b]quinazoline-2,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(Cl)cc1)n1[nH]c(=O)c(/N=N/c3ccccc3)c1N2 |
| InChI | InChI=1S/C22H18ClN5O2/c23-14-11-9-13(10-12-14)20-18-16(7-4-8-17(18)29)24-21-19(22(30)27-28(20)21)26-25-15-5-2-1-3-6-15/h1-3,5-6,9-12,20,24H,4,7-8H2,(H,27,30)/b26-25+ |
| InChIKey | SYGCXUJTXMCHKA-OCEACIFDSA-N |
| XLogP | 5.27 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|