C27H29NO3 — CID 137229215
4-methoxy-2-(3-pent-4-enoxybenzenecarboximidoyl)-6-(1-phenylethyl)phenol (PubChem CID 137229215) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 4-methoxy-2-(3-pent-4-enoxybenzenecarboximidoyl)-6-(1-phenylethyl)phenol.
| Compound Name | 4-methoxy-2-(3-pent-4-enoxybenzenecarboximidoyl)-6-(1-phenylethyl)phenol |
|---|---|
| PubChem CID | 137229215 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 4-methoxy-2-(3-pent-4-enoxybenzenecarboximidoyl)-6-(1-phenylethyl)phenol |
| SMILES | [H]/N=C(\c1cccc(OCCCC=C)c1)c1cc(OC)cc(C(C)c2ccccc2)c1O |
| InChI | InChI=1S/C27H29NO3/c1-4-5-9-15-31-22-14-10-13-21(16-22)26(28)25-18-23(30-3)17-24(27(25)29)19(2)20-11-7-6-8-12-20/h4,6-8,10-14,16-19,28-29H,1,5,9,15H2,2-3H3/b28-26+ |
| InChIKey | MUNPWIGXOVKSSH-BYCLXTJYSA-N |
| XLogP | 6.31 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|