C13H15N3O2 — CID 137230518
2-[(3S,5R)-5-hydroxypiperidin-3-yl]-3H-quinazolin-4-one (PubChem CID 137230518) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[(3S,5R)-5-hydroxypiperidin-3-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[(3S,5R)-5-hydroxypiperidin-3-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137230518 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-[(3S,5R)-5-hydroxypiperidin-3-yl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c([C@@H]2CNC[C@H](O)C2)nc2ccccc12 |
| InChI | InChI=1S/C13H15N3O2/c17-9-5-8(6-14-7-9)12-15-11-4-2-1-3-10(11)13(18)16-12/h1-4,8-9,14,17H,5-7H2,(H,15,16,18)/t8-,9+/m0/s1 |
| InChIKey | FTIQKLAAHVYHBF-DTWKUNHWSA-N |
| XLogP | 0.36 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |