C23H21N3O2 — CID 136832348
(1R,2S,3S,4R)-N-benzyl-3-(4-oxo-3H-quinazolin-2-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 136832348) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (1R,2S,3S,4R)-N-benzyl-3-(4-oxo-3H-quinazolin-2-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,3S,4R)-N-benzyl-3-(4-oxo-3H-quinazolin-2-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 136832348 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (1R,2S,3S,4R)-N-benzyl-3-(4-oxo-3H-quinazolin-2-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1[C@@H](c2nc3ccccc3c(=O)[nH]2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C23H21N3O2/c27-22-17-8-4-5-9-18(17)25-21(26-22)19-15-10-11-16(12-15)20(19)23(28)24-13-14-6-2-1-3-7-14/h1-11,15-16,19-20H,12-13H2,(H,24,28)(H,25,26,27)/t15-,16-,19-,20-/m0/s1 |
| InChIKey | VMLGKNQIBCPOOP-FVCZOJIISA-N |
| XLogP | 3.15 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|