C24H23N3O2 — CID 136832350
(1R,2S,3S,4R)-3-(4-oxo-3H-quinazolin-2-yl)-N-(2-phenylethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 136832350) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-(4-oxo-3H-quinazolin-2-yl)-N-(2-phenylethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,3S,4R)-3-(4-oxo-3H-quinazolin-2-yl)-N-(2-phenylethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 136832350 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (1R,2S,3S,4R)-3-(4-oxo-3H-quinazolin-2-yl)-N-(2-phenylethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)[C@@H]1[C@@H](c2nc3ccccc3c(=O)[nH]2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C24H23N3O2/c28-23-18-8-4-5-9-19(18)26-22(27-23)20-16-10-11-17(14-16)21(20)24(29)25-13-12-15-6-2-1-3-7-15/h1-11,16-17,20-21H,12-14H2,(H,25,29)(H,26,27,28)/t16-,17-,20-,21-/m0/s1 |
| InChIKey | GBEAYLZWZNFPJY-USNOLKROSA-N |
| XLogP | 3.19 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|