C15H19N3O4 — CID 137231142
tert-butyl 2-(hydroxyiminomethyl)spiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate (PubChem CID 137231142) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is tert-butyl 2-(hydroxyiminomethyl)spiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl 2-(hydroxyiminomethyl)spiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 137231142 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl 2-(hydroxyiminomethyl)spiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)OCc1nc(C=NO)ccc12 |
| InChI | InChI=1S/C15H19N3O4/c1-14(2,3)22-13(19)18-8-15(9-18)11-5-4-10(6-16-20)17-12(11)7-21-15/h4-6,20H,7-9H2,1-3H3 |
| InChIKey | IEOZEZSWBXYATF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|