C25H21Cl3F3NO4 — CID 118252743
tert-butyl 6-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate (PubChem CID 118252743) has the molecular formula C25H21Cl3F3NO4 and a molecular weight of 562.80 g/mol. Its IUPAC name is tert-butyl 6-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118252743 |
| Molecular Formula | C25H21Cl3F3NO4 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | tert-butyl 6-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)OCc1cc(C(=O)/C=C(\c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H21Cl3F3NO4/c1-23(2,3)36-22(34)32-11-24(12-32)16-5-4-13(6-15(16)10-35-24)20(33)9-17(25(29,30)31)14-7-18(26)21(28)19(27)8-14/h4-9H,10-12H2,1-3H3/b17-9+ |
| InChIKey | BLHFNXYGWNNBFT-RQZCQDPDSA-N |
| XLogP | 7.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|