C24H20Cl3F4NO3 — CID 78147743
tert-butyl 3-fluoro-3-[4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]phenyl]azetidine-1-carboxylate (PubChem CID 78147743) has the molecular formula C24H20Cl3F4NO3 and a molecular weight of 552.78 g/mol. Its IUPAC name is tert-butyl 3-fluoro-3-[4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]phenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-3-[4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]phenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 78147743 |
| Molecular Formula | C24H20Cl3F4NO3 |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | tert-butyl 3-fluoro-3-[4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]phenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(c2ccc(C(=O)C=C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H20Cl3F4NO3/c1-22(2,3)35-21(34)32-11-23(28,12-32)15-6-4-13(5-7-15)19(33)10-16(24(29,30)31)14-8-17(25)20(27)18(26)9-14/h4-10H,11-12H2,1-3H3 |
| InChIKey | UHFMZDBMCPKXQH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|