C17H24FNO3 — CID 156737294
tert-butyl 3-[3-ethyl-5-(hydroxymethyl)phenyl]-3-fluoroazetidine-1-carboxylate (PubChem CID 156737294) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is tert-butyl 3-[3-ethyl-5-(hydroxymethyl)phenyl]-3-fluoroazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-ethyl-5-(hydroxymethyl)phenyl]-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 156737294 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl 3-[3-ethyl-5-(hydroxymethyl)phenyl]-3-fluoroazetidine-1-carboxylate |
| SMILES | CCc1cc(CO)cc(C2(F)CN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C17H24FNO3/c1-5-12-6-13(9-20)8-14(7-12)17(18)10-19(11-17)15(21)22-16(2,3)4/h6-8,20H,5,9-11H2,1-4H3 |
| InChIKey | MFYVHBVIZWPUMN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |