C16H19ClN2O3 — CID 142532270
tert-butyl 6-carbonochloridimidoylspiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate (PubChem CID 142532270) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is tert-butyl 6-carbonochloridimidoylspiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-carbonochloridimidoylspiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 142532270 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | tert-butyl 6-carbonochloridimidoylspiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate |
| SMILES | [H]/N=C(\Cl)c1ccc2c(c1)COC21CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-15(2,3)22-14(20)19-8-16(9-19)12-5-4-10(13(17)18)6-11(12)7-21-16/h4-6,18H,7-9H2,1-3H3/b18-13- |
| InChIKey | WHGJTJUZWUVXBJ-AQTBWJFISA-N |
| XLogP | 3.23 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|