C11H19N5O4 — CID 137231164
(2R,5R)-2-(6-amino-2-methyl-2,3,7,8-tetrahydropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 137231164) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2R,5R)-2-(6-amino-2-methyl-2,3,7,8-tetrahydropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-amino-2-methyl-2,3,7,8-tetrahydropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 137231164 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2R,5R)-2-(6-amino-2-methyl-2,3,7,8-tetrahydropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC1N=C(N)C2=C(N1)N([C@@H]1O[C@H](CO)C(O)C1O)CN2 |
| InChI | InChI=1S/C11H19N5O4/c1-4-14-9(12)6-10(15-4)16(3-13-6)11-8(19)7(18)5(2-17)20-11/h4-5,7-8,11,13,15,17-19H,2-3H2,1H3,(H2,12,14)/t4?,5-,7?,8?,11-/m1/s1 |
| InChIKey | OIIDRMNCKAORCD-ZSVKBEIKSA-N |
| XLogP | -3.24 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |