C10H14N4O8S — CID 136609748
9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7,8-dihydro-1H-purine-2-sulfonic acid (PubChem CID 136609748) has the molecular formula C10H14N4O8S and a molecular weight of 350.31 g/mol. Its IUPAC name is 9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7,8-dihydro-1H-purine-2-sulfonic acid.
| Compound Name | 9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7,8-dihydro-1H-purine-2-sulfonic acid |
|---|---|
| PubChem CID | 136609748 |
| Molecular Formula | C10H14N4O8S |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7,8-dihydro-1H-purine-2-sulfonic acid |
| SMILES | O=c1[nH]c(S(=O)(=O)O)nc2c1NCN2[C@@H]1O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C10H14N4O8S/c15-1-3-5(16)6(17)9(22-3)14-2-11-4-7(14)12-10(13-8(4)18)23(19,20)21/h3,5-6,9,11,15-17H,1-2H2,(H,12,13,18)(H,19,20,21)/t3-,5+,6?,9-/m1/s1 |
| InChIKey | WVOAFRQFERKQKT-ACJOCUEISA-N |
| XLogP | -3.36 |
| TPSA | 185.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|