C14H16N4O6 — CID 142256539
3-[(3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,6,7-tetrahydroimidazo[4,5-g]phthalazine-5,8-dione (PubChem CID 142256539) has the molecular formula C14H16N4O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 3-[(3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,6,7-tetrahydroimidazo[4,5-g]phthalazine-5,8-dione.
| Compound Name | 3-[(3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,6,7-tetrahydroimidazo[4,5-g]phthalazine-5,8-dione |
|---|---|
| PubChem CID | 142256539 |
| Molecular Formula | C14H16N4O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[(3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,6,7-tetrahydroimidazo[4,5-g]phthalazine-5,8-dione |
| SMILES | O=c1[nH][nH]c(=O)c2cc3c(cc12)NCN3C1OC(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16N4O6/c19-3-9-10(20)11(21)14(24-9)18-4-15-7-1-5-6(2-8(7)18)13(23)17-16-12(5)22/h1-2,9-11,14-15,19-21H,3-4H2,(H,16,22)(H,17,23)/t9?,10-,11-,14?/m1/s1 |
| InChIKey | SDMGCSQGUGXKDO-JXRVJTEKSA-N |
| XLogP | -2.16 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |