C27H34N6O7 — CID 137233026
N-[3-[2-amino-7-[5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-2-[2-[1-amino-2-(3-methylphenoxy)ethoxy]ethoxy]acetamide (PubChem CID 137233026) has the molecular formula C27H34N6O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is N-[3-[2-amino-7-[5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-2-[2-[1-amino-2-(3-methylphenoxy)ethoxy]ethoxy]acetamide.
| Compound Name | N-[3-[2-amino-7-[5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-2-[2-[1-amino-2-(3-methylphenoxy)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 137233026 |
| Molecular Formula | C27H34N6O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | N-[3-[2-amino-7-[5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-2-[2-[1-amino-2-(3-methylphenoxy)ethoxy]ethoxy]acetamide |
| SMILES | Cc1cccc(OCC(N)OCCOCC(=O)NCC#Cc2cn(C3CCC(CO)O3)c3nc(N)[nH]c(=O)c23)c1 |
| InChI | InChI=1S/C27H34N6O7/c1-17-4-2-6-19(12-17)39-15-21(28)38-11-10-37-16-22(35)30-9-3-5-18-13-33(23-8-7-20(14-34)40-23)25-24(18)26(36)32-27(29)31-25/h2,4,6,12-13,20-21,23,34H,7-11,14-16,28H2,1H3,(H,30,35)(H3,29,31,32,36) |
| InChIKey | UCTQZZHKDYQHHF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 188.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|