C27H33N3O3 — CID 137239825
2-[1-[4-(4-methoxybenzoyl)piperidin-1-yl]-4-methylpentyl]-3H-quinazolin-4-one (PubChem CID 137239825) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[1-[4-(4-methoxybenzoyl)piperidin-1-yl]-4-methylpentyl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-[4-(4-methoxybenzoyl)piperidin-1-yl]-4-methylpentyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137239825 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-[1-[4-(4-methoxybenzoyl)piperidin-1-yl]-4-methylpentyl]-3H-quinazolin-4-one |
| SMILES | COc1ccc(C(=O)C2CCN(C(CCC(C)C)c3nc4ccccc4c(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C27H33N3O3/c1-18(2)8-13-24(26-28-23-7-5-4-6-22(23)27(32)29-26)30-16-14-20(15-17-30)25(31)19-9-11-21(33-3)12-10-19/h4-7,9-12,18,20,24H,8,13-17H2,1-3H3,(H,28,29,32) |
| InChIKey | YGPGBZUQTACDIS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |