C20H19FN4OS — CID 137245045
6-tert-butylsulfanyl-4-[(5-fluoro-1H-indazol-3-yl)amino]quinolin-7-ol (PubChem CID 137245045) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 6-tert-butylsulfanyl-4-[(5-fluoro-1H-indazol-3-yl)amino]quinolin-7-ol.
| Compound Name | 6-tert-butylsulfanyl-4-[(5-fluoro-1H-indazol-3-yl)amino]quinolin-7-ol |
|---|---|
| PubChem CID | 137245045 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-tert-butylsulfanyl-4-[(5-fluoro-1H-indazol-3-yl)amino]quinolin-7-ol |
| SMILES | CC(C)(C)Sc1cc2c(Nc3n[nH]c4ccc(F)cc34)ccnc2cc1O |
| InChI | InChI=1S/C20H19FN4OS/c1-20(2,3)27-18-9-12-14(6-7-22-16(12)10-17(18)26)23-19-13-8-11(21)4-5-15(13)24-25-19/h4-10,26H,1-3H3,(H2,22,23,24,25) |
| InChIKey | HKVLIFMJHUAIPT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |