C16H12F2N4O3 — CID 137247195
N-[(2,4-difluorophenyl)methyl]-1-hydroxy-4-imino-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 137247195) has the molecular formula C16H12F2N4O3 and a molecular weight of 346.29 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-hydroxy-4-imino-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-4-imino-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 137247195 |
| Molecular Formula | C16H12F2N4O3 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-4-imino-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | [H]/N=C1\c2cccnc2N(O)C(=O)C1C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H12F2N4O3/c17-9-4-3-8(11(18)6-9)7-21-15(23)12-13(19)10-2-1-5-20-14(10)22(25)16(12)24/h1-6,12,19,25H,7H2,(H,21,23)/b19-13+ |
| InChIKey | KQQAEMXQZXBXSU-CPNJWEJPSA-N |
| XLogP | 1.40 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|