About tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate
tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate (PubChem CID 137255720) has the molecular formula C16H24BrN5O2
and a molecular weight of 398.31 g/mol. Its IUPAC name is tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate |
| PubChem CID | 137255720 |
| Molecular Formula | C16H24BrN5O2 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate |
| SMILES | [H]/N=C/N=C(\N)c1[nH]c(C2CCN(C(=O)OC(C)(C)C)CC2)cc1Br |
| InChI | InChI=1S/C16H24BrN5O2/c1-16(2,3)24-15(23)22-6-4-10(5-7-22)12-8-11(17)13(21-12)14(19)20-9-18/h8-10,21H,4-7H2,1-3H3,(H3,18,19,20) |
| InChIKey | GQYFLGHIGUINGW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate (CID 137255720) is tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate is [H]/N=C/N=C(\N)c1[nH]c(C2CCN(C(=O)OC(C)(C)C)CC2)cc1Br.
What is the InChIKey of tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate?
The InChIKey is GQYFLGHIGUINGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BrN5O2/c1-16(2,3)24-15(23)22-6-4-10(5-7-22)12-8-11(17)13(21-12)14(19)20-9-18/h8-10,21H,4-7H2,1-3H3,(H3,18,19,20).
What are the key properties of tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate?
tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate has a molecular weight of 398.31 g/mol, XLogP of 3.20, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 137255720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).