C16H24BrN5O2 — CID 137255720
tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate (PubChem CID 137255720) has the molecular formula C16H24BrN5O2 and a molecular weight of 398.31 g/mol. Its IUPAC name is tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137255720 |
| Molecular Formula | C16H24BrN5O2 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | tert-butyl 4-[4-bromo-5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]piperidine-1-carboxylate |
| SMILES | [H]/N=C/N=C(\N)c1[nH]c(C2CCN(C(=O)OC(C)(C)C)CC2)cc1Br |
| InChI | InChI=1S/C16H24BrN5O2/c1-16(2,3)24-15(23)22-6-4-10(5-7-22)12-8-11(17)13(21-12)14(19)20-9-18/h8-10,21H,4-7H2,1-3H3,(H3,18,19,20) |
| InChIKey | GQYFLGHIGUINGW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|