C15H32N2O3 — CID 143937940
tert-butyl 4-methoxypiperidine-1-carboxylate;ethane;ethanimine (PubChem CID 143937940) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is tert-butyl 4-methoxypiperidine-1-carboxylate;ethane;ethanimine.
| Compound Name | tert-butyl 4-methoxypiperidine-1-carboxylate;ethane;ethanimine |
|---|---|
| PubChem CID | 143937940 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | tert-butyl 4-methoxypiperidine-1-carboxylate;ethane;ethanimine |
| SMILES | CC.COC1CCN(C(=O)OC(C)(C)C)CC1.[H]/N=C/C |
| InChI | InChI=1S/C11H21NO3.C2H5N.C2H6/c1-11(2,3)15-10(13)12-7-5-9(14-4)6-8-12;1-2-3;1-2/h9H,5-8H2,1-4H3;2-3H,1H3;1-2H3/b;3-2+; |
| InChIKey | CYHUDNKSXVRKJZ-VQSZBRBVSA-N |
| XLogP | 3.71 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|