C49H40N4O13 — CID 137256055
2-[2-[2-[2-[bis(carboxymethyl)amino]-5-[3-hydroxy-6-oxo-2,7-di(quinolin-4-yl)xanthen-9-yl]phenoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 137256055) has the molecular formula C49H40N4O13 and a molecular weight of 892.87 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis(carboxymethyl)amino]-5-[3-hydroxy-6-oxo-2,7-di(quinolin-4-yl)xanthen-9-yl]phenoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]-5-[3-hydroxy-6-oxo-2,7-di(quinolin-4-yl)xanthen-9-yl]phenoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 137256055 |
| Molecular Formula | C49H40N4O13 |
| Molecular Weight | 892.87 g/mol |
| Exact Mass | 892.26 |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]-5-[3-hydroxy-6-oxo-2,7-di(quinolin-4-yl)xanthen-9-yl]phenoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCOCCOc1cc(-c2c3cc(-c4ccnc5ccccc45)c(=O)cc-3oc3cc(O)c(-c4ccnc5ccccc45)cc23)ccc1N(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C49H40N4O13/c54-40-22-42-35(20-33(40)29-11-13-50-37-7-3-1-5-31(29)37)49(36-21-34(41(55)23-43(36)66-42)30-12-14-51-38-8-4-2-6-32(30)38)28-9-10-39(53(26-47(60)61)27-48(62)63)44(19-28)65-18-17-64-16-15-52(24-45(56)57)25-46(58)59/h1-14,19-23,54H,15-18,24-27H2,(H,56,57)(H,58,59)(H,60,61)(H,62,63) |
| InChIKey | CCHWJFCVBGMEJU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 250.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.87 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|