C17H18FN3O3S — CID 137256759
(1S,10R)-13-(4-fluorophenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 137256759) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is (1S,10R)-13-(4-fluorophenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10R)-13-(4-fluorophenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 137256759 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (1S,10R)-13-(4-fluorophenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)C[C@H]1CC[C@@H](C2)N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O3S/c1-10-19-16-9-13-5-4-12(8-15(16)17(22)20-10)21(13)25(23,24)14-6-2-11(18)3-7-14/h2-3,6-7,12-13H,4-5,8-9H2,1H3,(H,19,20,22)/t12-,13+/m1/s1 |
| InChIKey | FGYXISHQSZDKTO-OLZOCXBDSA-N |
| XLogP | 1.54 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |