C25H30N6O3 — CID 137256942
ethanimidoyl 3-[[(Z)-3-[(3-hydroxybenzoyl)-(1-methylpiperidin-4-yl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate (PubChem CID 137256942) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is ethanimidoyl 3-[[(Z)-3-[(3-hydroxybenzoyl)-(1-methylpiperidin-4-yl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate.
| Compound Name | ethanimidoyl 3-[[(Z)-3-[(3-hydroxybenzoyl)-(1-methylpiperidin-4-yl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate |
|---|---|
| PubChem CID | 137256942 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | ethanimidoyl 3-[[(Z)-3-[(3-hydroxybenzoyl)-(1-methylpiperidin-4-yl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1cccc(N/C=C\C(=N\[H])N(C(=O)c2cccc(O)c2)C2CCN(C)CC2)c1 |
| InChI | InChI=1S/C25H30N6O3/c1-17(26)34-24(28)18-5-3-7-20(15-18)29-12-9-23(27)31(21-10-13-30(2)14-11-21)25(33)19-6-4-8-22(32)16-19/h3-9,12,15-16,21,26-29,32H,10-11,13-14H2,1-2H3/b12-9-,26-17+,27-23-,28-24- |
| InChIKey | JRKUNCAZCIXXLW-CPAUTHDESA-N |
| XLogP | 3.87 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|