C21H26N4OS — CID 137249656
N-[(Z)-3-anilinobut-2-enimidoyl]-N-(1-methylpiperidin-4-yl)thiophene-2-carboxamide (PubChem CID 137249656) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[(Z)-3-anilinobut-2-enimidoyl]-N-(1-methylpiperidin-4-yl)thiophene-2-carboxamide.
| Compound Name | N-[(Z)-3-anilinobut-2-enimidoyl]-N-(1-methylpiperidin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 137249656 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[(Z)-3-anilinobut-2-enimidoyl]-N-(1-methylpiperidin-4-yl)thiophene-2-carboxamide |
| SMILES | [H]/N=C(\C=C(\C)Nc1ccccc1)N(C(=O)c1cccs1)C1CCN(C)CC1 |
| InChI | InChI=1S/C21H26N4OS/c1-16(23-17-7-4-3-5-8-17)15-20(22)25(18-10-12-24(2)13-11-18)21(26)19-9-6-14-27-19/h3-9,14-15,18,22-23H,10-13H2,1-2H3/b16-15-,22-20+ |
| InChIKey | SISLUGQZLDJZSD-XGNCDKEYSA-N |
| XLogP | 4.28 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|