C30H34N6O3S — CID 137249674
ethanimidoyl 3-[[(Z)-3-[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-(thiophene-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate (PubChem CID 137249674) has the molecular formula C30H34N6O3S and a molecular weight of 558.71 g/mol. Its IUPAC name is ethanimidoyl 3-[[(Z)-3-[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-(thiophene-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate.
| Compound Name | ethanimidoyl 3-[[(Z)-3-[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-(thiophene-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate |
|---|---|
| PubChem CID | 137249674 |
| Molecular Formula | C30H34N6O3S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | ethanimidoyl 3-[[(Z)-3-[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]-(thiophene-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1cccc(N/C=C\C(=N/[H])N(C(=O)c2cccs2)C2CCN(CC(O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C30H34N6O3S/c1-21(31)39-29(33)23-9-5-10-24(19-23)34-15-12-28(32)36(30(38)27-11-6-18-40-27)25-13-16-35(17-14-25)20-26(37)22-7-3-2-4-8-22/h2-12,15,18-19,25-26,31-34,37H,13-14,16-17,20H2,1H3/b15-12-,31-21+,32-28+,33-29- |
| InChIKey | GBBRHEACQGEEGD-DPTTWTCGSA-N |
| XLogP | 5.33 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|