C28H31N7O2S — CID 137249661
ethanimidoyl 3-[[(Z)-3-[(1-benzylpiperidin-4-yl)-(1,3-thiazole-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate (PubChem CID 137249661) has the molecular formula C28H31N7O2S and a molecular weight of 529.67 g/mol. Its IUPAC name is ethanimidoyl 3-[[(Z)-3-[(1-benzylpiperidin-4-yl)-(1,3-thiazole-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate.
| Compound Name | ethanimidoyl 3-[[(Z)-3-[(1-benzylpiperidin-4-yl)-(1,3-thiazole-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate |
|---|---|
| PubChem CID | 137249661 |
| Molecular Formula | C28H31N7O2S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | ethanimidoyl 3-[[(Z)-3-[(1-benzylpiperidin-4-yl)-(1,3-thiazole-2-carbonyl)amino]-3-iminoprop-1-enyl]amino]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1cccc(N/C=C\C(=N/[H])N(C(=O)c2nccs2)C2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H31N7O2S/c1-20(29)37-26(31)22-8-5-9-23(18-22)32-13-10-25(30)35(28(36)27-33-14-17-38-27)24-11-15-34(16-12-24)19-21-6-3-2-4-7-21/h2-10,13-14,17-18,24,29-32H,11-12,15-16,19H2,1H3/b13-10-,29-20+,30-25+,31-26- |
| InChIKey | SEQKBIPXEIWRMS-JTYOAWORSA-N |
| XLogP | 5.19 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|