C25H27FN2OS — CID 42703324
N-(1-benzylpiperidin-4-yl)-3-fluoro-N-[(3-methylthiophen-2-yl)methyl]benzamide (PubChem CID 42703324) has the molecular formula C25H27FN2OS and a molecular weight of 422.57 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-fluoro-N-[(3-methylthiophen-2-yl)methyl]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-fluoro-N-[(3-methylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 42703324 |
| Molecular Formula | C25H27FN2OS |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-fluoro-N-[(3-methylthiophen-2-yl)methyl]benzamide |
| SMILES | Cc1ccsc1CN(C(=O)c1cccc(F)c1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H27FN2OS/c1-19-12-15-30-24(19)18-28(25(29)21-8-5-9-22(26)16-21)23-10-13-27(14-11-23)17-20-6-3-2-4-7-20/h2-9,12,15-16,23H,10-11,13-14,17-18H2,1H3 |
| InChIKey | YVAIBIAUQBOYQS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |