C27H37N5O — CID 18630710
1-[1-(1-benzylpiperidin-4-yl)cycloheptyl]-3-(3-carbamimidoylphenyl)urea (PubChem CID 18630710) has the molecular formula C27H37N5O and a molecular weight of 447.63 g/mol. Its IUPAC name is 1-[1-(1-benzylpiperidin-4-yl)cycloheptyl]-3-(3-carbamimidoylphenyl)urea.
| Compound Name | 1-[1-(1-benzylpiperidin-4-yl)cycloheptyl]-3-(3-carbamimidoylphenyl)urea |
|---|---|
| PubChem CID | 18630710 |
| Molecular Formula | C27H37N5O |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 1-[1-(1-benzylpiperidin-4-yl)cycloheptyl]-3-(3-carbamimidoylphenyl)urea |
| SMILES | [H]/N=C(\N)c1cccc(NC(=O)NC2(C3CCN(Cc4ccccc4)CC3)CCCCCC2)c1 |
| InChI | InChI=1S/C27H37N5O/c28-25(29)22-11-8-12-24(19-22)30-26(33)31-27(15-6-1-2-7-16-27)23-13-17-32(18-14-23)20-21-9-4-3-5-10-21/h3-5,8-12,19,23H,1-2,6-7,13-18,20H2,(H3,28,29)(H2,30,31,33) |
| InChIKey | FERRBNMTYQKGHO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|