C27H37N5O — CID 70087612
1-(1-benzylpiperidin-3-yl)-1-(3-carbamimidoylphenyl)-3-cycloheptylurea (PubChem CID 70087612) has the molecular formula C27H37N5O and a molecular weight of 447.63 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-3-yl)-1-(3-carbamimidoylphenyl)-3-cycloheptylurea.
| Compound Name | 1-(1-benzylpiperidin-3-yl)-1-(3-carbamimidoylphenyl)-3-cycloheptylurea |
|---|---|
| PubChem CID | 70087612 |
| Molecular Formula | C27H37N5O |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 1-(1-benzylpiperidin-3-yl)-1-(3-carbamimidoylphenyl)-3-cycloheptylurea |
| SMILES | [H]/N=C(\N)c1cccc(N(C(=O)NC2CCCCCC2)C2CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C27H37N5O/c28-26(29)22-12-8-15-24(18-22)32(27(33)30-23-13-6-1-2-7-14-23)25-16-9-17-31(20-25)19-21-10-4-3-5-11-21/h3-5,8,10-12,15,18,23,25H,1-2,6-7,9,13-14,16-17,19-20H2,(H3,28,29)(H,30,33) |
| InChIKey | FKZGEOBDORURTI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|