C21H33N7O — CID 54176524
1-(3-carbamimidoylphenyl)-1-(1-carbamimidoylpiperidin-4-yl)-3-cycloheptylurea (PubChem CID 54176524) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(3-carbamimidoylphenyl)-1-(1-carbamimidoylpiperidin-4-yl)-3-cycloheptylurea.
| Compound Name | 1-(3-carbamimidoylphenyl)-1-(1-carbamimidoylpiperidin-4-yl)-3-cycloheptylurea |
|---|---|
| PubChem CID | 54176524 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 1-(3-carbamimidoylphenyl)-1-(1-carbamimidoylpiperidin-4-yl)-3-cycloheptylurea |
| SMILES | [H]/N=C(\N)c1cccc(N(C(=O)NC2CCCCCC2)C2CCN(/C(N)=N/[H])CC2)c1 |
| InChI | InChI=1S/C21H33N7O/c22-19(23)15-6-5-9-18(14-15)28(17-10-12-27(13-11-17)20(24)25)21(29)26-16-7-3-1-2-4-8-16/h5-6,9,14,16-17H,1-4,7-8,10-13H2,(H3,22,23)(H3,24,25)(H,26,29) |
| InChIKey | OYTXYZVGZHQRLD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|