C15H22N4O — CID 70653799
N-(1-carbamimidoylpiperidin-4-yl)-4-ethylbenzamide (PubChem CID 70653799) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(1-carbamimidoylpiperidin-4-yl)-4-ethylbenzamide.
| Compound Name | N-(1-carbamimidoylpiperidin-4-yl)-4-ethylbenzamide |
|---|---|
| PubChem CID | 70653799 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(1-carbamimidoylpiperidin-4-yl)-4-ethylbenzamide |
| SMILES | [H]/N=C(\N)N1CCC(NC(=O)c2ccc(CC)cc2)CC1 |
| InChI | InChI=1S/C15H22N4O/c1-2-11-3-5-12(6-4-11)14(20)18-13-7-9-19(10-8-13)15(16)17/h3-6,13H,2,7-10H2,1H3,(H3,16,17)(H,18,20) |
| InChIKey | XAOFDEOPGVJINE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|