C16H26N4O2S — CID 70653753
3-[3-(4-ethylphenyl)sulfonylpropylamino]pyrrolidine-1-carboximidamide (PubChem CID 70653753) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-[3-(4-ethylphenyl)sulfonylpropylamino]pyrrolidine-1-carboximidamide.
| Compound Name | 3-[3-(4-ethylphenyl)sulfonylpropylamino]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 70653753 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 3-[3-(4-ethylphenyl)sulfonylpropylamino]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(NCCCS(=O)(=O)c2ccc(CC)cc2)C1 |
| InChI | InChI=1S/C16H26N4O2S/c1-2-13-4-6-15(7-5-13)23(21,22)11-3-9-19-14-8-10-20(12-14)16(17)18/h4-7,14,19H,2-3,8-12H2,1H3,(H3,17,18) |
| InChIKey | FWIMYKGCHLFIOB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|