C24H20N3O4+ — CID 137257474
2-(4-hydroxy-3,5-dimethylphenyl)-5,7-dimethyl-5,9-diaza-7-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-2,7,9,11,13,15-hexaene-4,6,17-trione (PubChem CID 137257474) has the molecular formula C24H20N3O4+ and a molecular weight of 414.44 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethylphenyl)-5,7-dimethyl-5,9-diaza-7-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-2,7,9,11,13,15-hexaene-4,6,17-trione.
| Compound Name | 2-(4-hydroxy-3,5-dimethylphenyl)-5,7-dimethyl-5,9-diaza-7-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-2,7,9,11,13,15-hexaene-4,6,17-trione |
|---|---|
| PubChem CID | 137257474 |
| Molecular Formula | C24H20N3O4+ |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethylphenyl)-5,7-dimethyl-5,9-diaza-7-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-2,7,9,11,13,15-hexaene-4,6,17-trione |
| SMILES | Cc1cc(C2=C3C(=O)N(C)C(=O)[N+](C)=C3N=C3c4ccccc4C(=O)C32)cc(C)c1O |
| InChI | InChI=1S/C24H19N3O4/c1-11-9-13(10-12(2)20(11)28)16-17-19(14-7-5-6-8-15(14)21(17)29)25-22-18(16)23(30)27(4)24(31)26(22)3/h5-10,17H,1-4H3/p+1 |
| InChIKey | XQBBLQQXEPKTLC-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|