C20H20N4O4 — CID 137257525
7-[[1-(2-methoxyphenyl)cyclobutyl]methylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137257525) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 7-[[1-(2-methoxyphenyl)cyclobutyl]methylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[[1-(2-methoxyphenyl)cyclobutyl]methylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137257525 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 7-[[1-(2-methoxyphenyl)cyclobutyl]methylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | COc1ccccc1C1(CNc2cc3nc[nH]c(=O)c3cc2[N+](=O)[O-])CCC1 |
| InChI | InChI=1S/C20H20N4O4/c1-28-18-6-3-2-5-14(18)20(7-4-8-20)11-21-16-10-15-13(9-17(16)24(26)27)19(25)23-12-22-15/h2-3,5-6,9-10,12,21H,4,7-8,11H2,1H3,(H,22,23,25) |
| InChIKey | ZYWVKBNMWPQXPA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|