C19H14ClFN2O2 — CID 137260305
2-chloro-6-fluoro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide (PubChem CID 137260305) has the molecular formula C19H14ClFN2O2 and a molecular weight of 356.78 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide |
|---|---|
| PubChem CID | 137260305 |
| Molecular Formula | C19H14ClFN2O2 |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-chloro-6-fluoro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide |
| SMILES | O=C1NC2=C/C(=N/C(=O)c3c(F)cccc3Cl)C=CC2C2=C1CCC2 |
| InChI | InChI=1S/C19H14ClFN2O2/c20-14-5-2-6-15(21)17(14)19(25)22-10-7-8-12-11-3-1-4-13(11)18(24)23-16(12)9-10/h2,5-9,12H,1,3-4H2,(H,23,24)/b22-10+ |
| InChIKey | WKFCUSLUYBBPKR-LSHDLFTRSA-N |
| XLogP | 3.74 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|