C18H15ClN2O2 — CID 137259538
2-chloro-N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)benzamide (PubChem CID 137259538) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)benzamide.
| Compound Name | 2-chloro-N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)benzamide |
|---|---|
| PubChem CID | 137259538 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-chloro-N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)benzamide |
| SMILES | CC1=C(C)C2C=C/C(=N\C(=O)c3ccccc3Cl)C=C2NC1=O |
| InChI | InChI=1S/C18H15ClN2O2/c1-10-11(2)17(22)21-16-9-12(7-8-13(10)16)20-18(23)14-5-3-4-6-15(14)19/h3-9,13H,1-2H3,(H,21,22)/b20-12+ |
| InChIKey | RCHKSAYTQPZRLR-UDWIEESQSA-N |
| XLogP | 3.46 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|