C19H15Cl2N3O3S — CID 136614126
N-[5-[2-amino-1-(4-chloro-2-methylphenyl)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-chlorobenzamide (PubChem CID 136614126) has the molecular formula C19H15Cl2N3O3S and a molecular weight of 436.32 g/mol. Its IUPAC name is N-[5-[2-amino-1-(4-chloro-2-methylphenyl)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-chlorobenzamide.
| Compound Name | N-[5-[2-amino-1-(4-chloro-2-methylphenyl)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-chlorobenzamide |
|---|---|
| PubChem CID | 136614126 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-[5-[2-amino-1-(4-chloro-2-methylphenyl)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-chlorobenzamide |
| SMILES | Cc1cc(Cl)ccc1C(C(N)=O)C1S/C(=N\C(=O)c2ccccc2Cl)NC1=O |
| InChI | InChI=1S/C19H15Cl2N3O3S/c1-9-8-10(20)6-7-11(9)14(16(22)25)15-18(27)24-19(28-15)23-17(26)12-4-2-3-5-13(12)21/h2-8,14-15H,1H3,(H2,22,25)(H,23,24,26,27) |
| InChIKey | CWAAKOMBGRCCJK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|