C11H10ClN3O2S — CID 135795638
(3Z)-1-(4-chlorophenyl)-3-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 135795638) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is (3Z)-1-(4-chlorophenyl)-3-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-(4-chlorophenyl)-3-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 135795638 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (3Z)-1-(4-chlorophenyl)-3-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | C[C@@H]1S/C(=N\C(=O)Nc2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C11H10ClN3O2S/c1-6-9(16)14-11(18-6)15-10(17)13-8-4-2-7(12)3-5-8/h2-6H,1H3,(H2,13,14,15,16,17)/t6-/m0/s1 |
| InChIKey | IEHUWDYGSVPWTE-LURJTMIESA-N |
| XLogP | 2.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|