C12H13ClN2OS — CID 135857052
2-[(1S)-1-(4-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one (PubChem CID 135857052) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 2-[(1S)-1-(4-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(1S)-1-(4-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135857052 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-[(1S)-1-(4-chlorophenyl)ethyl]imino-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC1S/C(=N/[C@@H](C)c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C12H13ClN2OS/c1-7(9-3-5-10(13)6-4-9)14-12-15-11(16)8(2)17-12/h3-8H,1-2H3,(H,14,15,16)/t7-,8?/m0/s1 |
| InChIKey | IVNSSEZQAQYYRW-JAMMHHFISA-N |
| XLogP | 3.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|