C17H18FN3OS — CID 136607285
(5S,6Z,10E)-2-[1-(4-fluorophenyl)ethylimino]-5-methyl-1-thia-3,9-diazacycloundeca-6,8,10-trien-4-one (PubChem CID 136607285) has the molecular formula C17H18FN3OS and a molecular weight of 331.42 g/mol. Its IUPAC name is (5S,6Z,10E)-2-[1-(4-fluorophenyl)ethylimino]-5-methyl-1-thia-3,9-diazacycloundeca-6,8,10-trien-4-one.
| Compound Name | (5S,6Z,10E)-2-[1-(4-fluorophenyl)ethylimino]-5-methyl-1-thia-3,9-diazacycloundeca-6,8,10-trien-4-one |
|---|---|
| PubChem CID | 136607285 |
| Molecular Formula | C17H18FN3OS |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (5S,6Z,10E)-2-[1-(4-fluorophenyl)ethylimino]-5-methyl-1-thia-3,9-diazacycloundeca-6,8,10-trien-4-one |
| SMILES | CC(/N=C1/NC(=O)[C@@H](C)/C=C\C=N/C=C/S1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3OS/c1-12-4-3-9-19-10-11-23-17(21-16(12)22)20-13(2)14-5-7-15(18)8-6-14/h3-13H,1-2H3,(H,20,21,22)/b4-3-,11-10+,19-9-/t12-,13?/m0/s1 |
| InChIKey | AFCOHFYUWZXTSU-JQFIMXGTSA-N |
| XLogP | 3.84 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|