About 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine
2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine (PubChem CID 143468662) has the molecular formula C18H19F2N3OS
and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine.
Molecular Properties
| Compound Name | 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine |
| PubChem CID | 143468662 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine |
| SMILES | CC1S/C(=N/C(C)c2ccc(F)cc2F)NC1=O.Cc1ccncc1 |
| InChI | InChI=1S/C12H12F2N2OS.C6H7N/c1-6(9-4-3-8(13)5-10(9)14)15-12-16-11(17)7(2)18-12;1-6-2-4-7-5-3-6/h3-7H,1-2H3,(H,15,16,17);2-5H,1H3 |
| InChIKey | MLIYSADEPFFMBH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine?
The IUPAC name of 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine (CID 143468662) is 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine.
What is the SMILES notation for 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine?
The canonical SMILES for 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine is CC1S/C(=N/C(C)c2ccc(F)cc2F)NC1=O.Cc1ccncc1.
What is the InChIKey of 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine?
The InChIKey is MLIYSADEPFFMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2OS.C6H7N/c1-6(9-4-3-8(13)5-10(9)14)15-12-16-11(17)7(2)18-12;1-6-2-4-7-5-3-6/h3-7H,1-2H3,(H,15,16,17);2-5H,1H3.
What are the key properties of 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine?
2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine has a molecular weight of 363.43 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-difluorophenyl)ethylimino]-5-methyl-1,3-thiazolidin-4-one;4-methylpyridine is sourced from PubChem (CID 143468662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).