C17H12F5N3OS — CID 135989404
2-[(1R)-1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one (PubChem CID 135989404) has the molecular formula C17H12F5N3OS and a molecular weight of 401.36 g/mol. Its IUPAC name is 2-[(1R)-1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(1R)-1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989404 |
| Molecular Formula | C17H12F5N3OS |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-[(1R)-1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one |
| SMILES | CC1(c2ccncc2)S/C(=N\[C@H](c2ccc(F)cc2F)C(F)(F)F)NC1=O |
| InChI | InChI=1S/C17H12F5N3OS/c1-16(9-4-6-23-7-5-9)14(26)25-15(27-16)24-13(17(20,21)22)11-3-2-10(18)8-12(11)19/h2-8,13H,1H3,(H,24,25,26)/t13-,16?/m1/s1 |
| InChIKey | RFVZZHYAJRMCPN-JBZHPUCOSA-N |
| XLogP | 4.10 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|