About bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+)
bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) (PubChem CID 11678747) has the molecular formula C20H20Cl2N4O2PdS2
and a molecular weight of 589.87 g/mol. Its IUPAC name is bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+).
Molecular Properties
| Compound Name | bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) |
| PubChem CID | 11678747 |
| Molecular Formula | C20H20Cl2N4O2PdS2 |
| Molecular Weight | 589.87 g/mol |
| Exact Mass | 587.94 |
| IUPAC Name | bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) |
| SMILES | CN(C)/C([S-])=N/C(=O)c1ccccc1Cl.CN(C)/C([S-])=N\C(=O)c1ccccc1Cl.[Pd+2] |
| InChI | InChI=1S/2C10H11ClN2OS.Pd/c2*1-13(2)10(15)12-9(14)7-5-3-4-6-8(7)11;/h2*3-6H,1-2H3,(H,12,14,15);/q;;+2/p-2 |
| InChIKey | OLICGMKHODVDOH-UHFFFAOYSA-L |
| XLogP | 3.89 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 589.87 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+)?
The IUPAC name of bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) (CID 11678747) is bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+).
What is the SMILES notation for bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+)?
The canonical SMILES for bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) is CN(C)/C([S-])=N/C(=O)c1ccccc1Cl.CN(C)/C([S-])=N\C(=O)c1ccccc1Cl.[Pd+2].
What is the InChIKey of bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+)?
The InChIKey is OLICGMKHODVDOH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H11ClN2OS.Pd/c2*1-13(2)10(15)12-9(14)7-5-3-4-6-8(7)11;/h2*3-6H,1-2H3,(H,12,14,15);/q;;+2/p-2.
What are the key properties of bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+)?
bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) has a molecular weight of 589.87 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N'-(2-chlorobenzoyl)-N,N-dimethylcarbamimidothioate);palladium(2+) is sourced from PubChem (CID 11678747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).