C24H24Cl2N4O2PdS2 — CID 11707259
bis(N-(2-chlorobenzoyl)pyrrolidine-1-carboximidothioate);palladium(2+) (PubChem CID 11707259) has the molecular formula C24H24Cl2N4O2PdS2 and a molecular weight of 641.94 g/mol. Its IUPAC name is bis(N-(2-chlorobenzoyl)pyrrolidine-1-carboximidothioate);palladium(2+).
| Compound Name | bis(N-(2-chlorobenzoyl)pyrrolidine-1-carboximidothioate);palladium(2+) |
|---|---|
| PubChem CID | 11707259 |
| Molecular Formula | C24H24Cl2N4O2PdS2 |
| Molecular Weight | 641.94 g/mol |
| Exact Mass | 639.98 |
| IUPAC Name | bis(N-(2-chlorobenzoyl)pyrrolidine-1-carboximidothioate);palladium(2+) |
| SMILES | O=C(/N=C(/[S-])N1CCCC1)c1ccccc1Cl.O=C(/N=C(\[S-])N1CCCC1)c1ccccc1Cl.[Pd+2] |
| InChI | InChI=1S/2C12H13ClN2OS.Pd/c2*13-10-6-2-1-5-9(10)11(16)14-12(17)15-7-3-4-8-15;/h2*1-2,5-6H,3-4,7-8H2,(H,14,16,17);/q;;+2/p-2 |
| InChIKey | SSIWZSDCAGQMLI-UHFFFAOYSA-L |
| XLogP | 4.96 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|