About propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate
propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate (PubChem CID 4664400) has the molecular formula C18H26ClN3O2
and a molecular weight of 351.88 g/mol. Its IUPAC name is propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate.
Molecular Properties
| Compound Name | propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
| PubChem CID | 4664400 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
| SMILES | CC(C)O/C(=N/C(=O)c1ccccc1Cl)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H26ClN3O2/c1-13(2)24-18(22(4)14-9-11-21(3)12-10-14)20-17(23)15-7-5-6-8-16(15)19/h5-8,13-14H,9-12H2,1-4H3/b20-18+ |
| InChIKey | SPZCGBMLRLUNPS-CZIZESTLSA-N |
| XLogP | 3.29 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate?
The IUPAC name of propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate (CID 4664400) is propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate.
What is the SMILES notation for propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate?
The canonical SMILES for propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate is CC(C)O/C(=N/C(=O)c1ccccc1Cl)N(C)C1CCN(C)CC1.
What is the InChIKey of propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate?
The InChIKey is SPZCGBMLRLUNPS-CZIZESTLSA-N. The full InChI is InChI=1S/C18H26ClN3O2/c1-13(2)24-18(22(4)14-9-11-21(3)12-10-14)20-17(23)15-7-5-6-8-16(15)19/h5-8,13-14H,9-12H2,1-4H3/b20-18+.
What are the key properties of propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate?
propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate has a molecular weight of 351.88 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N'-(2-chlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate is sourced from PubChem (CID 4664400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).