C17H23Cl2N3O2 — CID 46125916
ethyl N'-(3,4-dichlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate (PubChem CID 46125916) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is ethyl N'-(3,4-dichlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate.
| Compound Name | ethyl N'-(3,4-dichlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
|---|---|
| PubChem CID | 46125916 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl N'-(3,4-dichlorobenzoyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
| SMILES | CCO/C(=N\C(=O)c1ccc(Cl)c(Cl)c1)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O2/c1-4-24-17(22(3)13-7-9-21(2)10-8-13)20-16(23)12-5-6-14(18)15(19)11-12/h5-6,11,13H,4,7-10H2,1-3H3/b20-17- |
| InChIKey | ZZMFXPITDGNZJQ-JZJYNLBNSA-N |
| XLogP | 3.55 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|