C15H23N3O3 — CID 7301572
ethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate (PubChem CID 7301572) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is ethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate.
| Compound Name | ethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
|---|---|
| PubChem CID | 7301572 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | ethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
| SMILES | CCO/C(=N\C(=O)c1ccco1)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-4-20-15(16-14(19)13-6-5-11-21-13)18(3)12-7-9-17(2)10-8-12/h5-6,11-12H,4,7-10H2,1-3H3/b16-15- |
| InChIKey | SDIBVFQXZDBXSB-NXVVXOECSA-N |
| XLogP | 1.84 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|