C19H27N3O4 — CID 7265416
propyl N'-(1,3-benzodioxole-5-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate (PubChem CID 7265416) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is propyl N'-(1,3-benzodioxole-5-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate.
| Compound Name | propyl N'-(1,3-benzodioxole-5-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
|---|---|
| PubChem CID | 7265416 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | propyl N'-(1,3-benzodioxole-5-carbonyl)-N-methyl-N-(1-methylpiperidin-4-yl)carbamimidate |
| SMILES | CCCO/C(=N\C(=O)c1ccc2c(c1)OCO2)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-4-11-24-19(22(3)15-7-9-21(2)10-8-15)20-18(23)14-5-6-16-17(12-14)26-13-25-16/h5-6,12,15H,4,7-11,13H2,1-3H3/b20-19- |
| InChIKey | CURNOCBDRIANCG-VXPUYCOJSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|