About 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate
2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate (PubChem CID 7296039) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate.
Molecular Properties
| Compound Name | 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate |
| PubChem CID | 7296039 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate |
| SMILES | COCCO/C(=N\C(=O)c1ccco1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2O4/c1-19(13-14-7-4-3-5-8-14)17(23-12-11-21-2)18-16(20)15-9-6-10-22-15/h3-10H,11-13H2,1-2H3/b18-17- |
| InChIKey | GWVKZBZYPGXBLX-ZCXUNETKSA-N |
| XLogP | 2.57 |
| TPSA | 64.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate?
The IUPAC name of 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate (CID 7296039) is 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate.
What is the SMILES notation for 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate?
The canonical SMILES for 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate is COCCO/C(=N\C(=O)c1ccco1)N(C)Cc1ccccc1.
What is the InChIKey of 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate?
The InChIKey is GWVKZBZYPGXBLX-ZCXUNETKSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-19(13-14-7-4-3-5-8-14)17(23-12-11-21-2)18-16(20)15-9-6-10-22-15/h3-10H,11-13H2,1-2H3/b18-17-.
What are the key properties of 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate?
2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate has a molecular weight of 316.36 g/mol, XLogP of 2.57, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl N-benzyl-N'-(furan-2-carbonyl)-N-methylcarbamimidate is sourced from PubChem (CID 7296039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).