C20H26N2O6 — CID 7301876
2-methoxyethyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(furan-2-carbonyl)-N-methylcarbamimidate (PubChem CID 7301876) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(furan-2-carbonyl)-N-methylcarbamimidate.
| Compound Name | 2-methoxyethyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(furan-2-carbonyl)-N-methylcarbamimidate |
|---|---|
| PubChem CID | 7301876 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-methoxyethyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(furan-2-carbonyl)-N-methylcarbamimidate |
| SMILES | COCCO/C(=N\C(=O)c1ccco1)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O6/c1-22(10-9-15-7-8-16(25-3)18(14-15)26-4)20(28-13-12-24-2)21-19(23)17-6-5-11-27-17/h5-8,11,14H,9-10,12-13H2,1-4H3/b21-20- |
| InChIKey | HBGYCKCFTQGEDX-MRCUWXFGSA-N |
| XLogP | 2.63 |
| TPSA | 82.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|