C22H27FN2O4 — CID 7481921
propyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(3-fluorobenzoyl)-N-methylcarbamimidate (PubChem CID 7481921) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is propyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(3-fluorobenzoyl)-N-methylcarbamimidate.
| Compound Name | propyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(3-fluorobenzoyl)-N-methylcarbamimidate |
|---|---|
| PubChem CID | 7481921 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | propyl N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(3-fluorobenzoyl)-N-methylcarbamimidate |
| SMILES | CCCO/C(=N\C(=O)c1cccc(F)c1)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H27FN2O4/c1-5-13-29-22(24-21(26)17-7-6-8-18(23)15-17)25(2)12-11-16-9-10-19(27-3)20(14-16)28-4/h6-10,14-15H,5,11-13H2,1-4H3/b24-22- |
| InChIKey | UBRTZQMTQDLYBL-GYHWCHFESA-N |
| XLogP | 3.94 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|